What is the name of this compound ch3ch2ch2ch2cooh?
Table of Contents
What is the name of this compound ch3ch2ch2ch2cooh?
Now -e in pentane is replaced by -oic acid so now the name of the organic compound is pentanoic acid.
What is the common name of pentanoic acid?
valeric acid
For example, valeric acid is the common name for a straight-chain carboxylic acid having five carbons. The official IUPAC name is pentanoic acid….Carboxylic Acids.
| #C | 5 |
|---|---|
| IUPAC Name | pentanoic acid |
| Common Name | valeric acid |
| IUPAC Anion Name | pentanoate |
| Common Anion Name | valerate |
What is CH3CH2CH2CH2CH2CH2COOH?
CH3CH2CH2CH2CH2CH2COOH is a weak acid. The molecule contains the –COOH group (carboxylic acid group).
What is the formula of valeric acid?
C5H10O2
Valeric acid/Formula
What is CH3CH2CH2CONH2?
Butyramide or butanamide is the IUPAC name for CH3CH2CH2CONH2.
What is the common name of hexanoic acid?
Caproic acid
Caproic acid, also known as hexanoic acid, is the carboxylic acid derived from hexane with the chemical formula CH3(CH2)4COOH.
What is pentanoic acid metabolite?
Valeric acid, or pentanoic acid, is a straight chain alkyl carboxylic acid with the chemical formula CH3(CH2)3COOH. Valeric acid is largely considered as a gut microbial metabolite. Recently, valeric acid has been found to exert strong gut protective effects.
What is the formula of hexanoic acid?
C6H12O2
Caproic acid/Formula
What is the Iupac name of valeric acid?
pentanoic acid
| IUPAC Name | pentanoic acid |
|---|---|
| Alternative Names | Valeric acid PENTANOIC ACID n-Pentanoic acid |
| Molecular Formula | C5H10O2 |
| Molar Mass | 102.133 g/mol |
| InChI | InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) |
What do amides end?
Simple amides are named as derivatives of carboxylic acids. The -ic ending of the common name or the -oic ending of the International Union of Pure and Applied Chemistry (IUPAC) name of the carboxylic acid is replaced with the suffix -amide.