What is the IUPAC name of C2H5 co C2H5?
Table of Contents
- 1 What is the IUPAC name of C2H5 co C2H5?
- 2 What is the IUPAC name of CH3 CO C2H5?
- 3 What is the IUPAC name of CH3 3CC CH3 3?
- 4 What is the IUPAC name of benzophenone?
- 5 What is the IUPAC name of CH3 ch2 NH CH3?
- 6 What is the molecular formula of CH3 CO C2H5?
- 7 What is the Iupac name of CH3 2CHCH2C CH3 3?
- 8 What is the name of the compound CH3?
- 9 What is IUPAC name in chemistry?
What is the IUPAC name of C2H5 co C2H5?
Species:
| NAME: | methyl ethyl ketone, MEK, 2-butanone |
|---|---|
| FORMULA: | CH3C(O)C2H5 |
| CAS RN: | 78-93-3 |
| STRUCTURE (FROM NIST): | |
| InChIKey: | ZWEHNKRNPOVVGH-UHFFFAOYSA-N |
What is the IUPAC name of CH3 CO C2H5?
✯The common name if given carbon compound is Methyl Ethyl ketone and it’s IUPAC name is Propanone.
What is the IUPAC name of CH3 3CC CH3 3?
hexamethyl ethane
Species:
| NAME: | hexamethyl ethane, 2,3,3-tetramethyl butane |
|---|---|
| FORMULA: | (CH3)3CC(CH3)3 |
| CAS RN: | 594-82-1 |
| STRUCTURE (FROM NIST): | |
| InChIKey: | OMMLUKLXGSRPHK-UHFFFAOYSA-N |
What is the IUPAC name of CH3 3?
The preferred name is 2-ethoxy-2-methylpropane but you can use the functional class names so we can make 3 extra IUPAC names: 2-ethoxy-2-methylpropane (PIN)
What is the IUPAC name of ch3 ch2 NH ch3?
The IUPAC name of the given compound is n-methyl ethyl amine. The IUPAC name of CH3CH2NHCH3is N-methyl ethyl amine.
What is the IUPAC name of benzophenone?
diphenylmethanone
| IUPAC Name | diphenylmethanone |
|---|---|
| Alternative Names | BENZOPHENONE diphenylmethanone Diphenyl ketone |
| Molecular Formula | C13H10O |
| Molar Mass | 182.222 g/mol |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
What is the IUPAC name of CH3 ch2 NH CH3?
What is the molecular formula of CH3 CO C2H5?
Draw the structure of Butanone molecule, CH3COC2H5.
What is the Iupac name for CH3CH2C CH3 2ch3?
3,3-dimethylhexane
IUPAC name of CH3CH2C(CH3)2CH2CH2CH3 C H 3 C H 2 C ( C H 3 ) 2 C H 2 C H 2 C H 3 is 3,3-dimethylhexane.
What is the Iupac name for CH3 3 C ch2 ch2 CH3?
3, 3-Dimethyl-1-butene.
What is the Iupac name of CH3 2CHCH2C CH3 3?
2,2,4-trimethylpentane
Species:
| NAME: | 2,2,4-trimethylpentane |
|---|---|
| FORMULA: | (CH3)2CHCH2C(CH3)3 |
| CAS RN: | 540-84-1 |
| STRUCTURE (FROM NIST): | |
| InChIKey: | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
What is the name of the compound CH3?
Butyraldehyde, also known as butanal, is an organic compound with the formula CH3(CH2)2CHO. This compound is the aldehyde derivative of butane. It is a colourless flammable liquid with an acrid smell.
What is IUPAC name in chemistry?
In chemical nomenclature, the IUPAC nomenclature of organic chemistry is a systematic method of naming organic chemical compounds as recommended by the International Union of Pure and Applied Chemistry (IUPAC). It is published in the Nomenclature of Organic Chemistry (informally called the Blue Book).
What is the IUPAC name of the following compounds?
The IUPAC name for the compound FeS is Iron(II)Sulfide. IUPAC stands for International Union of Pure and Applied Chemistry. This is an organization that establishes official names of chemical elements and compounds. Hope this is the answer that you are looking for.
https://www.youtube.com/watch?v=YDJBqaql7jk